About tetraoctylazanium hydroxide
tetraoctylazanium hydroxide (PubChem CID 10994503) has the molecular formula C32H69NO
and a molecular weight of 483.91 g/mol. Its IUPAC name is tetraoctylazanium hydroxide.
Molecular Properties
| Compound Name | tetraoctylazanium hydroxide |
| PubChem CID | 10994503 |
| Molecular Formula | C32H69NO |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.54 |
| IUPAC Name | tetraoctylazanium hydroxide |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[OH-] |
| InChI | InChI=1S/C32H68N.H2O/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | DCFYRBLFVWYBIJ-UHFFFAOYSA-M |
| XLogP | 11.07 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetraoctylazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraoctylazanium hydroxide?
The IUPAC name of tetraoctylazanium hydroxide (CID 10994503) is tetraoctylazanium hydroxide.
What is the SMILES notation for tetraoctylazanium hydroxide?
The canonical SMILES for tetraoctylazanium hydroxide is CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[OH-].
What is the InChIKey of tetraoctylazanium hydroxide?
The InChIKey is DCFYRBLFVWYBIJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C32H68N.H2O/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H2/q+1;/p-1.
What are the key properties of tetraoctylazanium hydroxide?
tetraoctylazanium hydroxide has a molecular weight of 483.91 g/mol, XLogP of 11.07, 28 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetraoctylazanium hydroxide is sourced from PubChem (CID 10994503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).