C33H33NO4 — CID 10994777
(4R,4aS,7aR,12bS)-3-(2-ethylphenyl)-9-hydroxy-4a-(3-phenylpropoxy)-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 10994777) has the molecular formula C33H33NO4 and a molecular weight of 507.63 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(2-ethylphenyl)-9-hydroxy-4a-(3-phenylpropoxy)-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,7aR,12bS)-3-(2-ethylphenyl)-9-hydroxy-4a-(3-phenylpropoxy)-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 10994777 |
| Molecular Formula | C33H33NO4 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(2-ethylphenyl)-9-hydroxy-4a-(3-phenylpropoxy)-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CCc1ccccc1N1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)C=C[C@@]3(OCCCc2ccccc2)[C@H]1C5 |
| InChI | InChI=1S/C33H33NO4/c1-2-23-12-6-7-13-25(23)34-19-18-32-29-24-14-15-26(35)30(29)38-31(32)27(36)16-17-33(32,28(34)21-24)37-20-8-11-22-9-4-3-5-10-22/h3-7,9-10,12-17,28,31,35H,2,8,11,18-21H2,1H3/t28-,31+,32+,33-/m1/s1 |
| InChIKey | JNJIXLJFLZYPQA-KYXYXWHUSA-N |
| XLogP | 5.32 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|