C17H15NO4 — CID 15605737
(1S,5R,13S,19R)-8-hydroxy-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-2,7,9,11-tetraen-4-one (PubChem CID 15605737) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (1S,5R,13S,19R)-8-hydroxy-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-2,7,9,11-tetraen-4-one.
| Compound Name | (1S,5R,13S,19R)-8-hydroxy-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-2,7,9,11-tetraen-4-one |
|---|---|
| PubChem CID | 15605737 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (1S,5R,13S,19R)-8-hydroxy-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-2,7,9,11-tetraen-4-one |
| SMILES | O=C1C=C[C@]23OCN4CC[C@@]25c2c(ccc(O)c2O[C@@H]15)C[C@@H]43 |
| InChI | InChI=1S/C17H15NO4/c19-10-2-1-9-7-12-17-4-3-11(20)15-16(17,13(9)14(10)22-15)5-6-18(12)8-21-17/h1-4,12,15,19H,5-8H2/t12-,15+,16+,17-/m1/s1 |
| InChIKey | UZMOHLIXRDALSG-ISWURRPUSA-N |
| XLogP | 0.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |