C20H19NO5 — CID 157412009
[(4R,4aS,7aR,12bS)-3-formyl-9-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate (PubChem CID 157412009) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-3-formyl-9-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate.
| Compound Name | [(4R,4aS,7aR,12bS)-3-formyl-9-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
|---|---|
| PubChem CID | 157412009 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-3-formyl-9-methyl-7-oxo-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl] acetate |
| SMILES | CC(=O)O[C@@]12C=CC(=O)[C@@H]3Oc4c(C)ccc5c4[C@@]31CCN(C=O)[C@@H]2C5 |
| InChI | InChI=1S/C20H19NO5/c1-11-3-4-13-9-15-20(26-12(2)23)6-5-14(24)18-19(20,7-8-21(15)10-22)16(13)17(11)25-18/h3-6,10,15,18H,7-9H2,1-2H3/t15-,18+,19+,20-/m1/s1 |
| InChIKey | QXDUTUVELGQKKW-XFWGSAIBSA-N |
| XLogP | 1.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|