C18H20NO4+ — CID 162270232
(3R,4aS,7aR,12bS)-3,4a-dihydroxy-3,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 162270232) has the molecular formula C18H20NO4+ and a molecular weight of 314.36 g/mol. Its IUPAC name is (3R,4aS,7aR,12bS)-3,4a-dihydroxy-3,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4aS,7aR,12bS)-3,4a-dihydroxy-3,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 162270232 |
| Molecular Formula | C18H20NO4+ |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (3R,4aS,7aR,12bS)-3,4a-dihydroxy-3,9-dimethyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | Cc1ccc2c3c1O[C@H]1C(=O)C=C[C@@]4(O)C(C2)[N@+](C)(O)CC[C@]314 |
| InChI | InChI=1S/C18H20NO4/c1-10-3-4-11-9-13-18(21)6-5-12(20)16-17(18,7-8-19(13,2)22)14(11)15(10)23-16/h3-6,13,16,21-22H,7-9H2,1-2H3/q+1/t13?,16-,17-,18+,19+/m0/s1 |
| InChIKey | NXFBXWOIFYFXBC-ILCIXLSASA-N |
| XLogP | 1.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|