C24H27NO6 — CID 10002522
[(4R,4aS,7S,7aR,12bS)-4a-acetyloxy-9-methoxy-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 10002522) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is [(4R,4aS,7S,7aR,12bS)-4a-acetyloxy-9-methoxy-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(4R,4aS,7S,7aR,12bS)-4a-acetyloxy-9-methoxy-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 10002522 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [(4R,4aS,7S,7aR,12bS)-4a-acetyloxy-9-methoxy-3-prop-2-enyl-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | C=CCN1CC[C@]23c4c5ccc(OC)c4O[C@H]2[C@@H](OC(C)=O)C=C[C@@]3(OC(C)=O)[C@H]1C5 |
| InChI | InChI=1S/C24H27NO6/c1-5-11-25-12-10-23-20-16-6-7-17(28-4)21(20)30-22(23)18(29-14(2)26)8-9-24(23,19(25)13-16)31-15(3)27/h5-9,18-19,22H,1,10-13H2,2-4H3/t18-,19+,22-,23-,24+/m0/s1 |
| InChIKey | XHRNFAWSIWNZBG-VKJMTUIMSA-N |
| XLogP | 2.31 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|