C21H29NO4Si — CID 11111857
(4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-trimethylsilyloxy-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 11111857) has the molecular formula C21H29NO4Si and a molecular weight of 387.55 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-trimethylsilyloxy-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-trimethylsilyloxy-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 11111857 |
| Molecular Formula | C21H29NO4Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (4R,4aS,7aR,12bS)-9-methoxy-3-methyl-4a-trimethylsilyloxy-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C(O)C=C[C@@]4(O[Si](C)(C)C)[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C21H29NO4Si/c1-22-11-10-20-17-13-6-7-15(24-2)18(17)25-19(20)14(23)8-9-21(20,16(22)12-13)26-27(3,4)5/h6-9,14,16,19,23H,10-12H2,1-5H3/t14?,16-,19+,20+,21-/m1/s1 |
| InChIKey | JIWDVWHEZFKRMB-WMCMNEEHSA-N |
| XLogP | 2.48 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|