C22H29NO3 — CID 159452794
(4R,4aR,7S,7aR,12bS)-3,4a-dimethyl-9-[(2-methylpropan-2-yl)oxy]-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (PubChem CID 159452794) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3,4a-dimethyl-9-[(2-methylpropan-2-yl)oxy]-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3,4a-dimethyl-9-[(2-methylpropan-2-yl)oxy]-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
|---|---|
| PubChem CID | 159452794 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3,4a-dimethyl-9-[(2-methylpropan-2-yl)oxy]-1,2,4,7,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | CN1CC[C@]23c4c5ccc(OC(C)(C)C)c4O[C@H]2[C@@H](O)C=C[C@@]3(C)[C@H]1C5 |
| InChI | InChI=1S/C22H29NO3/c1-20(2,3)26-15-7-6-13-12-16-21(4)9-8-14(24)19-22(21,10-11-23(16)5)17(13)18(15)25-19/h6-9,14,16,19,24H,10-12H2,1-5H3/t14-,16+,19-,21-,22-/m0/s1 |
| InChIKey | BQPJSBRHHZRHKS-DQLUXGLISA-N |
| XLogP | 3.06 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|