C26H40N6O7 — CID 10995208
(8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide (PubChem CID 10995208) has the molecular formula C26H40N6O7 and a molecular weight of 548.64 g/mol. Its IUPAC name is (8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide.
| Compound Name | (8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
|---|---|
| PubChem CID | 10995208 |
| Molecular Formula | C26H40N6O7 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (8S,11R,12S)-12-N-hydroxy-3-methyl-11-(2-methylpropyl)-2,10-dioxo-8-N-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](C(=O)NCC(=O)Nc2ccccn2)CCCCN(C)C(=O)OCCC[C@@H]1C(=O)NO |
| InChI | InChI=1S/C26H40N6O7/c1-17(2)15-19-18(24(35)31-38)9-8-14-39-26(37)32(3)13-7-5-10-20(29-23(19)34)25(36)28-16-22(33)30-21-11-4-6-12-27-21/h4,6,11-12,17-20,38H,5,7-10,13-16H2,1-3H3,(H,28,36)(H,29,34)(H,31,35)(H,27,30,33)/t18-,19+,20-/m0/s1 |
| InChIKey | HNLAFIYYYXHJFP-ZCNNSNEGSA-N |
| XLogP | 1.44 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|