C34H51N5O7 — CID 10995831
(2S)-2-[[(2S)-3-(1-methoxyindol-3-yl)-2-[[(2S)-8-oxo-2-[[(2R)-piperidine-2-carbonyl]amino]decanoyl]amino]propanoyl]amino]-3-methylpentanoic acid (PubChem CID 10995831) has the molecular formula C34H51N5O7 and a molecular weight of 641.81 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(1-methoxyindol-3-yl)-2-[[(2S)-8-oxo-2-[[(2R)-piperidine-2-carbonyl]amino]decanoyl]amino]propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(1-methoxyindol-3-yl)-2-[[(2S)-8-oxo-2-[[(2R)-piperidine-2-carbonyl]amino]decanoyl]amino]propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 10995831 |
| Molecular Formula | C34H51N5O7 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.38 |
| IUPAC Name | (2S)-2-[[(2S)-3-(1-methoxyindol-3-yl)-2-[[(2S)-8-oxo-2-[[(2R)-piperidine-2-carbonyl]amino]decanoyl]amino]propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)[C@H]1CCCCN1)C(=O)N[C@@H](Cc1cn(OC)c2ccccc12)C(=O)N[C@H](C(=O)O)C(C)CC |
| InChI | InChI=1S/C34H51N5O7/c1-5-22(3)30(34(44)45)38-33(43)28(20-23-21-39(46-4)29-18-11-10-15-25(23)29)37-32(42)27(17-9-7-8-14-24(40)6-2)36-31(41)26-16-12-13-19-35-26/h10-11,15,18,21-22,26-28,30,35H,5-9,12-14,16-17,19-20H2,1-4H3,(H,36,41)(H,37,42)(H,38,43)(H,44,45)/t22?,26-,27+,28+,30+/m1/s1 |
| InChIKey | JUVOHTXDKPDIML-MDAGPVMQSA-N |
| XLogP | 2.90 |
| TPSA | 167.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|