C33H49N5O6 — CID 88971164
(2R)-N-[(2S)-1-[[(2S)-3-(1-methoxyindol-3-yl)-1-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopropan-2-yl]amino]-1,8-dioxodecan-2-yl]piperidine-2-carboxamide (PubChem CID 88971164) has the molecular formula C33H49N5O6 and a molecular weight of 611.78 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[[(2S)-3-(1-methoxyindol-3-yl)-1-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopropan-2-yl]amino]-1,8-dioxodecan-2-yl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-[(2S)-1-[[(2S)-3-(1-methoxyindol-3-yl)-1-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopropan-2-yl]amino]-1,8-dioxodecan-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 88971164 |
| Molecular Formula | C33H49N5O6 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | (2R)-N-[(2S)-1-[[(2S)-3-(1-methoxyindol-3-yl)-1-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopropan-2-yl]amino]-1,8-dioxodecan-2-yl]piperidine-2-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)[C@H]1CCCCN1)C(=O)N[C@@H](Cc1cn(OC)c2ccccc12)C(=O)NC(C=O)C(C)C |
| InChI | InChI=1S/C33H49N5O6/c1-5-24(40)13-7-6-8-16-27(35-31(41)26-15-11-12-18-34-26)32(42)36-28(33(43)37-29(21-39)22(2)3)19-23-20-38(44-4)30-17-10-9-14-25(23)30/h9-10,14,17,20-22,26-29,34H,5-8,11-13,15-16,18-19H2,1-4H3,(H,35,41)(H,36,42)(H,37,43)/t26-,27+,28+,29?/m1/s1 |
| InChIKey | LWVMMMQSMHCRPB-KTAILRFMSA-N |
| XLogP | 2.62 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|