C7H15NO3 — CID 10997956
(3R,4S,6S)-6-(hydroxymethyl)azepane-3,4-diol (PubChem CID 10997956) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (3R,4S,6S)-6-(hydroxymethyl)azepane-3,4-diol.
| Compound Name | (3R,4S,6S)-6-(hydroxymethyl)azepane-3,4-diol |
|---|---|
| PubChem CID | 10997956 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (3R,4S,6S)-6-(hydroxymethyl)azepane-3,4-diol |
| SMILES | OC[C@@H]1CNC[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C7H15NO3/c9-4-5-1-6(10)7(11)3-8-2-5/h5-11H,1-4H2/t5-,6-,7+/m0/s1 |
| InChIKey | SNNXMJBVKDEAAY-LYFYHCNISA-N |
| XLogP | -1.69 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |