C6H13NO2 — CID 55287998
(3R,5S)-5-(hydroxymethyl)piperidin-3-ol (PubChem CID 55287998) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is (3R,5S)-5-(hydroxymethyl)piperidin-3-ol.
| Compound Name | (3R,5S)-5-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 55287998 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3R,5S)-5-(hydroxymethyl)piperidin-3-ol |
| SMILES | OC[C@@H]1CNC[C@H](O)C1 |
| InChI | InChI=1S/C6H13NO2/c8-4-5-1-6(9)3-7-2-5/h5-9H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | XCPUOKRBVCHXNS-NTSWFWBYSA-N |
| XLogP | -1.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |