C12H24OSi — CID 10998343
(1R,2R,3R)-2-prop-2-enyl-3-trimethylsilylcyclohexan-1-ol (PubChem CID 10998343) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is (1R,2R,3R)-2-prop-2-enyl-3-trimethylsilylcyclohexan-1-ol.
| Compound Name | (1R,2R,3R)-2-prop-2-enyl-3-trimethylsilylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10998343 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (1R,2R,3R)-2-prop-2-enyl-3-trimethylsilylcyclohexan-1-ol |
| SMILES | C=CC[C@@H]1[C@H](O)CCC[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi/c1-5-7-10-11(13)8-6-9-12(10)14(2,3)4/h5,10-13H,1,6-9H2,2-4H3/t10-,11-,12-/m1/s1 |
| InChIKey | XXNZPLNQOLKAFN-IJLUTSLNSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|