C12H18O4 — CID 10998707
(3aR,4aR,8aR,9aS)-2,2-dimethyl-3a,4,4a,5,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-g]isochromen-7-one (PubChem CID 10998707) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3aR,4aR,8aR,9aS)-2,2-dimethyl-3a,4,4a,5,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-g]isochromen-7-one.
| Compound Name | (3aR,4aR,8aR,9aS)-2,2-dimethyl-3a,4,4a,5,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-g]isochromen-7-one |
|---|---|
| PubChem CID | 10998707 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3aR,4aR,8aR,9aS)-2,2-dimethyl-3a,4,4a,5,8,8a,9,9a-octahydro-[1,3]dioxolo[4,5-g]isochromen-7-one |
| SMILES | CC1(C)O[C@H]2C[C@@H]3CC(=O)OC[C@@H]3C[C@H]2O1 |
| InChI | InChI=1S/C12H18O4/c1-12(2)15-9-3-7-5-11(13)14-6-8(7)4-10(9)16-12/h7-10H,3-6H2,1-2H3/t7-,8+,9+,10-/m1/s1 |
| InChIKey | BAFVXYRZZOOUDW-XFWSIPNHSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |