C14H20O4 — CID 10015087
(1'S,4'R,5'S,8'S,12'S)-5'-methylspiro[1,3-dioxolane-2,7'-2-oxatricyclo[6.3.1.04,12]dodecane]-3'-one (PubChem CID 10015087) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1'S,4'R,5'S,8'S,12'S)-5'-methylspiro[1,3-dioxolane-2,7'-2-oxatricyclo[6.3.1.04,12]dodecane]-3'-one.
| Compound Name | (1'S,4'R,5'S,8'S,12'S)-5'-methylspiro[1,3-dioxolane-2,7'-2-oxatricyclo[6.3.1.04,12]dodecane]-3'-one |
|---|---|
| PubChem CID | 10015087 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1'S,4'R,5'S,8'S,12'S)-5'-methylspiro[1,3-dioxolane-2,7'-2-oxatricyclo[6.3.1.04,12]dodecane]-3'-one |
| SMILES | C[C@H]1CC2(OCCO2)[C@H]2CCC[C@@H]3OC(=O)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C14H20O4/c1-8-7-14(16-5-6-17-14)9-3-2-4-10-12(9)11(8)13(15)18-10/h8-12H,2-7H2,1H3/t8-,9-,10-,11+,12+/m0/s1 |
| InChIKey | CQTGGUUEBIBGFC-KKJSVHSVSA-N |
| XLogP | 1.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |