C24H38O6 — CID 162991214
methyl (1R,2R,4S,9S,10R,13R,14R,17S)-2-acetyloxy-17-methoxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate (PubChem CID 162991214) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is methyl (1R,2R,4S,9S,10R,13R,14R,17S)-2-acetyloxy-17-methoxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate.
| Compound Name | methyl (1R,2R,4S,9S,10R,13R,14R,17S)-2-acetyloxy-17-methoxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate |
|---|---|
| PubChem CID | 162991214 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | methyl (1R,2R,4S,9S,10R,13R,14R,17S)-2-acetyloxy-17-methoxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3C[C@@H](OC(C)=O)[C@@]23[C@@H](OC)OC[C@H]13 |
| InChI | InChI=1S/C24H38O6/c1-14(25)30-19-12-18-22(2,3)10-7-11-23(18,4)17-9-8-15(20(26)27-5)16-13-29-21(28-6)24(16,17)19/h15-19,21H,7-13H2,1-6H3/t15-,16-,17-,18+,19-,21+,23-,24+/m1/s1 |
| InChIKey | WZCJEMNTJGERON-AEKUAFIYSA-N |
| XLogP | 3.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |