C15H24O2 — CID 10999005
(8S,8aS)-8-hexyl-4-methyl-2,6,8,8a-tetrahydrofuro[2,3-c]oxepine (PubChem CID 10999005) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (8S,8aS)-8-hexyl-4-methyl-2,6,8,8a-tetrahydrofuro[2,3-c]oxepine.
| Compound Name | (8S,8aS)-8-hexyl-4-methyl-2,6,8,8a-tetrahydrofuro[2,3-c]oxepine |
|---|---|
| PubChem CID | 10999005 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (8S,8aS)-8-hexyl-4-methyl-2,6,8,8a-tetrahydrofuro[2,3-c]oxepine |
| SMILES | CCCCCC[C@@H]1OCC=C(C)C2=CCO[C@@H]21 |
| InChI | InChI=1S/C15H24O2/c1-3-4-5-6-7-14-15-13(9-11-17-15)12(2)8-10-16-14/h8-9,14-15H,3-7,10-11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | ZOMULPABIKMMJG-GJZGRUSLSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|