C26H24N2O5S — CID 1099906
2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-naphthalen-1-ylacetamide (PubChem CID 1099906) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 1099906 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-naphthalen-1-ylacetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2cccc3ccccc23)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H24N2O5S/c1-32-24-16-15-20(17-25(24)33-2)28(34(30,31)21-11-4-3-5-12-21)18-26(29)27-23-14-8-10-19-9-6-7-13-22(19)23/h3-17H,18H2,1-2H3,(H,27,29) |
| InChIKey | MSVIHYZTBRMGOL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |