C22H22N2O5S — CID 998314
2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-phenylacetamide (PubChem CID 998314) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-phenylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-phenylacetamide |
|---|---|
| PubChem CID | 998314 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethoxyanilino]-N-phenylacetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccccc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H22N2O5S/c1-28-20-14-13-18(15-21(20)29-2)24(30(26,27)19-11-7-4-8-12-19)16-22(25)23-17-9-5-3-6-10-17/h3-15H,16H2,1-2H3,(H,23,25) |
| InChIKey | RMLMKMCEJNBIKR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |