C27H23ClN2O5S — CID 30170290
2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-(4-phenoxyphenyl)acetamide (PubChem CID 30170290) has the molecular formula C27H23ClN2O5S and a molecular weight of 523.01 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30170290 |
| Molecular Formula | C27H23ClN2O5S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-(4-phenoxyphenyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)S(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C27H23ClN2O5S/c1-34-26-17-14-21(18-25(26)28)30(36(32,33)24-10-6-3-7-11-24)19-27(31)29-20-12-15-23(16-13-20)35-22-8-4-2-5-9-22/h2-18H,19H2,1H3,(H,29,31) |
| InChIKey | UDSGMUHUSYRWOC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |