C16H23NO2S — CID 110000175
4-ethylsulfanyl-N-[2-(hydroxymethyl)-2-methylcyclopentyl]benzamide (PubChem CID 110000175) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-ethylsulfanyl-N-[2-(hydroxymethyl)-2-methylcyclopentyl]benzamide.
| Compound Name | 4-ethylsulfanyl-N-[2-(hydroxymethyl)-2-methylcyclopentyl]benzamide |
|---|---|
| PubChem CID | 110000175 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-ethylsulfanyl-N-[2-(hydroxymethyl)-2-methylcyclopentyl]benzamide |
| SMILES | CCSc1ccc(C(=O)NC2CCCC2(C)CO)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-3-20-13-8-6-12(7-9-13)15(19)17-14-5-4-10-16(14,2)11-18/h6-9,14,18H,3-5,10-11H2,1-2H3,(H,17,19) |
| InChIKey | MPJYXAJXXJMACF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |