C16H19N3O3 — CID 110001567
N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 110001567) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 110001567 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O3/c1-10-14(11(2)19(3)18-10)15(21)16(22)17-13(9-20)12-7-5-4-6-8-12/h4-8,13,20H,9H2,1-3H3,(H,17,22)/t13-/m1/s1 |
| InChIKey | UEORLAPFRGEBHQ-CYBMUJFWSA-N |
| XLogP | 1.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|