About N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide
N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 110002674) has the molecular formula C16H21N3O2S
and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 110002674 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCC(C)(CCO)NC(=O)Cc1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-16(2,6-8-20)19-14(21)9-13-11-22-15(18-13)12-5-4-7-17-10-12/h4-5,7,10-11,20H,3,6,8-9H2,1-2H3,(H,19,21) |
| InChIKey | HKSWLPKZCILIQU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide (CID 110002674) is N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide is CCC(C)(CCO)NC(=O)Cc1csc(-c2cccnc2)n1.
What is the InChIKey of N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide?
The InChIKey is HKSWLPKZCILIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2S/c1-3-16(2,6-8-20)19-14(21)9-13-11-22-15(18-13)12-5-4-7-17-10-12/h4-5,7,10-11,20H,3,6,8-9H2,1-2H3,(H,19,21).
What are the key properties of N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide?
N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide has a molecular weight of 319.43 g/mol, XLogP of 2.41, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3-methylpentan-3-yl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 110002674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).