C17H24ClNO3 — CID 110003754
3-(4-chlorophenyl)-3-hydroxy-N-[(2-hydroxycyclohexyl)methyl]-N-methylpropanamide (PubChem CID 110003754) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-hydroxy-N-[(2-hydroxycyclohexyl)methyl]-N-methylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-3-hydroxy-N-[(2-hydroxycyclohexyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 110003754 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-(4-chlorophenyl)-3-hydroxy-N-[(2-hydroxycyclohexyl)methyl]-N-methylpropanamide |
| SMILES | CN(CC1CCCCC1O)C(=O)CC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClNO3/c1-19(11-13-4-2-3-5-15(13)20)17(22)10-16(21)12-6-8-14(18)9-7-12/h6-9,13,15-16,20-21H,2-5,10-11H2,1H3 |
| InChIKey | CFPULLTUYLNZSF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |