C17H14ClN3O3 — CID 110004538
N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-oxo-1H-cinnoline-3-carboxamide (PubChem CID 110004538) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-oxo-1H-cinnoline-3-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-oxo-1H-cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 110004538 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-oxo-1H-cinnoline-3-carboxamide |
| SMILES | O=C(NC(CO)c1ccc(Cl)cc1)c1n[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C17H14ClN3O3/c18-11-7-5-10(6-8-11)14(9-22)19-17(24)15-16(23)12-3-1-2-4-13(12)20-21-15/h1-8,14,22H,9H2,(H,19,24)(H,20,23) |
| InChIKey | MZBONOCLLOYISN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |