C14H12F3NO2 — CID 110005116
1-[[4-(hydroxymethyl)phenyl]methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 110005116) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-[[4-(hydroxymethyl)phenyl]methyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[[4-(hydroxymethyl)phenyl]methyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 110005116 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-[[4-(hydroxymethyl)phenyl]methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)12-5-6-13(20)18(8-12)7-10-1-3-11(9-19)4-2-10/h1-6,8,19H,7,9H2 |
| InChIKey | RJCHCANFMNRYOU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |