C16H18F3N3O2 — CID 110006368
N-(3-ethylphenyl)-2-[4-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 110006368) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[4-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[4-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 110006368 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(3-ethylphenyl)-2-[4-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCc1cccc(NC(=O)Cn2cc(CCO)c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C16H18F3N3O2/c1-2-11-4-3-5-13(8-11)20-14(24)10-22-9-12(6-7-23)15(21-22)16(17,18)19/h3-5,8-9,23H,2,6-7,10H2,1H3,(H,20,24) |
| InChIKey | OPATZTHGMWEDGO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |