C19H27NO2S — CID 110006974
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]ethanone (PubChem CID 110006974) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]ethanone |
|---|---|
| PubChem CID | 110006974 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]ethanone |
| SMILES | O=C(CSCc1ccc(CO)cc1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C19H27NO2S/c21-12-15-7-9-16(10-8-15)13-23-14-19(22)20-11-3-5-17-4-1-2-6-18(17)20/h7-10,17-18,21H,1-6,11-14H2 |
| InChIKey | NTUYZELOJUDQSJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |