C15H21NO2S — CID 66262476
1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone (PubChem CID 66262476) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone.
| Compound Name | 1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone |
|---|---|
| PubChem CID | 66262476 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone |
| SMILES | Cc1ccc(CSCC(=O)N2CCC[C@H]2CO)cc1 |
| InChI | InChI=1S/C15H21NO2S/c1-12-4-6-13(7-5-12)10-19-11-15(18)16-8-2-3-14(16)9-17/h4-7,14,17H,2-3,8-11H2,1H3/t14-/m0/s1 |
| InChIKey | PSMUUQCIOZRTBL-AWEZNQCLSA-N |
| XLogP | 2.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |