C16H15ClFNO2S — CID 110007033
N-(5-chloro-2-fluorophenyl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]acetamide (PubChem CID 110007033) has the molecular formula C16H15ClFNO2S and a molecular weight of 339.82 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 110007033 |
| Molecular Formula | C16H15ClFNO2S |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-[[4-(hydroxymethyl)phenyl]methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc(CO)cc1)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H15ClFNO2S/c17-13-5-6-14(18)15(7-13)19-16(21)10-22-9-12-3-1-11(8-20)2-4-12/h1-7,20H,8-10H2,(H,19,21) |
| InChIKey | RQNJFFGUILHHAN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |