C16H24N2O2S — CID 110007137
1-(3-ethylsulfanylcyclopentyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea (PubChem CID 110007137) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-(3-ethylsulfanylcyclopentyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea.
| Compound Name | 1-(3-ethylsulfanylcyclopentyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 110007137 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-(3-ethylsulfanylcyclopentyl)-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
| SMILES | CCSC1CCC(NC(=O)N[C@H](CO)c2ccccc2)C1 |
| InChI | InChI=1S/C16H24N2O2S/c1-2-21-14-9-8-13(10-14)17-16(20)18-15(11-19)12-6-4-3-5-7-12/h3-7,13-15,19H,2,8-11H2,1H3,(H2,17,18,20)/t13?,14?,15-/m1/s1 |
| InChIKey | LOAMOMANUDJZJM-YMAMQOFZSA-N |
| XLogP | 2.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |