C19H29N3O2 — CID 95969050
1-[(3R)-1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea (PubChem CID 95969050) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(3R)-1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea.
| Compound Name | 1-[(3R)-1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 95969050 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(3R)-1-(cyclopentylmethyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
| SMILES | O=C(N[C@@H]1CCN(CC2CCCC2)C1)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C19H29N3O2/c23-14-18(16-8-2-1-3-9-16)21-19(24)20-17-10-11-22(13-17)12-15-6-4-5-7-15/h1-3,8-9,15,17-18,23H,4-7,10-14H2,(H2,20,21,24)/t17-,18-/m1/s1 |
| InChIKey | GWGQDVGKPNNNOR-QZTJIDSGSA-N |
| XLogP | 2.28 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |