C18H21FN4O2 — CID 75448750
1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea (PubChem CID 75448750) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea.
| Compound Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
|---|---|
| PubChem CID | 75448750 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[(1S)-2-hydroxy-1-phenylethyl]urea |
| SMILES | O=C(NC1CCN(c2ncccc2F)C1)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C18H21FN4O2/c19-15-7-4-9-20-17(15)23-10-8-14(11-23)21-18(25)22-16(12-24)13-5-2-1-3-6-13/h1-7,9,14,16,24H,8,10-12H2,(H2,21,22,25)/t14?,16-/m1/s1 |
| InChIKey | SONZYVYVGXJTQR-BZSJEYESSA-N |
| XLogP | 1.83 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |