C17H24FN3O2 — CID 126776040
2-(3-ethoxycyclobutyl)-N-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]acetamide (PubChem CID 126776040) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(3-ethoxycyclobutyl)-N-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(3-ethoxycyclobutyl)-N-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126776040 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(3-ethoxycyclobutyl)-N-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]acetamide |
| SMILES | CCOC1CC(CC(=O)NC2CCN(c3ncccc3F)C2)C1 |
| InChI | InChI=1S/C17H24FN3O2/c1-2-23-14-8-12(9-14)10-16(22)20-13-5-7-21(11-13)17-15(18)4-3-6-19-17/h3-4,6,12-14H,2,5,7-11H2,1H3,(H,20,22) |
| InChIKey | UIMOEILWAQUTCB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |