C14H22FN3O2S — CID 97306329
N-[(3S)-1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]pentane-1-sulfonamide (PubChem CID 97306329) has the molecular formula C14H22FN3O2S and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[(3S)-1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]pentane-1-sulfonamide.
| Compound Name | N-[(3S)-1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 97306329 |
| Molecular Formula | C14H22FN3O2S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[(3S)-1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]pentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)N[C@H]1CCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C14H22FN3O2S/c1-2-3-4-10-21(19,20)17-12-7-9-18(11-12)14-13(15)6-5-8-16-14/h5-6,8,12,17H,2-4,7,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | LVPIQTJFEZMADJ-LBPRGKRZSA-N |
| XLogP | 1.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|