C11H13ClF2N2O2 — CID 110007147
1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,2-difluoroethyl)urea (PubChem CID 110007147) has the molecular formula C11H13ClF2N2O2 and a molecular weight of 278.69 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,2-difluoroethyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,2-difluoroethyl)urea |
|---|---|
| PubChem CID | 110007147 |
| Molecular Formula | C11H13ClF2N2O2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,2-difluoroethyl)urea |
| SMILES | O=C(NCC(F)F)NC(CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClF2N2O2/c12-8-3-1-7(2-4-8)9(6-17)16-11(18)15-5-10(13)14/h1-4,9-10,17H,5-6H2,(H2,15,16,18) |
| InChIKey | CFONBLOADUVVSE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |