C18H26O3 — CID 11000774
(1R,4S,7R,8R,11S,12R)-6,6,12-trimethyl-2-methylidene-9-oxo-5-oxatricyclo[9.3.0.04,8]tetradecane-7-carbaldehyde (PubChem CID 11000774) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1R,4S,7R,8R,11S,12R)-6,6,12-trimethyl-2-methylidene-9-oxo-5-oxatricyclo[9.3.0.04,8]tetradecane-7-carbaldehyde.
| Compound Name | (1R,4S,7R,8R,11S,12R)-6,6,12-trimethyl-2-methylidene-9-oxo-5-oxatricyclo[9.3.0.04,8]tetradecane-7-carbaldehyde |
|---|---|
| PubChem CID | 11000774 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1R,4S,7R,8R,11S,12R)-6,6,12-trimethyl-2-methylidene-9-oxo-5-oxatricyclo[9.3.0.04,8]tetradecane-7-carbaldehyde |
| SMILES | C=C1C[C@@H]2OC(C)(C)[C@H](C=O)[C@H]2C(=O)C[C@H]2[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C18H26O3/c1-10-5-6-12-11(2)7-16-17(15(20)8-13(10)12)14(9-19)18(3,4)21-16/h9-10,12-14,16-17H,2,5-8H2,1,3-4H3/t10-,12+,13+,14-,16+,17+/m1/s1 |
| InChIKey | SNNZASMLCOZGIF-HFCAQADZSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|