C19H28O2 — CID 15812712
(1S,3S,4R,7R,10S,13S,16S)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecan-15-one (PubChem CID 15812712) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1S,3S,4R,7R,10S,13S,16S)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecan-15-one.
| Compound Name | (1S,3S,4R,7R,10S,13S,16S)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecan-15-one |
|---|---|
| PubChem CID | 15812712 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1S,3S,4R,7R,10S,13S,16S)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecan-15-one |
| SMILES | C=C1C[C@@H]2OC(C)(C)[C@H]3CC(=O)[C@@H](C[C@H]4[C@H](C)CC[C@@H]14)[C@@H]23 |
| InChI | InChI=1S/C19H28O2/c1-10-5-6-12-11(2)7-17-18-14(8-13(10)12)16(20)9-15(18)19(3,4)21-17/h10,12-15,17-18H,2,5-9H2,1,3-4H3/t10-,12+,13+,14-,15+,17+,18-/m1/s1 |
| InChIKey | KGEOIIFYJMRZTR-DJACPVBPSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|