C19H26O2 — CID 134924259
(3S,4R,7R,10S,13R)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadec-1(16)-en-15-one (PubChem CID 134924259) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (3S,4R,7R,10S,13R)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadec-1(16)-en-15-one.
| Compound Name | (3S,4R,7R,10S,13R)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadec-1(16)-en-15-one |
|---|---|
| PubChem CID | 134924259 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3S,4R,7R,10S,13R)-4,12,12-trimethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadec-1(16)-en-15-one |
| SMILES | C=C1C[C@@H]2OC(C)(C)[C@@H]3CC(=O)C(=C23)C[C@H]2[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C19H26O2/c1-10-5-6-12-11(2)7-17-18-14(8-13(10)12)16(20)9-15(18)19(3,4)21-17/h10,12-13,15,17H,2,5-9H2,1,3-4H3/t10-,12+,13+,15-,17+/m1/s1 |
| InChIKey | ZRTJTZNEZIFPPJ-VUOJEKOBSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|