C19H21F2NO2 — CID 110008205
[4-[[4-(2,4-difluorophenoxy)piperidin-1-yl]methyl]phenyl]methanol (PubChem CID 110008205) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is [4-[[4-(2,4-difluorophenoxy)piperidin-1-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[4-(2,4-difluorophenoxy)piperidin-1-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 110008205 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [4-[[4-(2,4-difluorophenoxy)piperidin-1-yl]methyl]phenyl]methanol |
| SMILES | OCc1ccc(CN2CCC(Oc3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C19H21F2NO2/c20-16-5-6-19(18(21)11-16)24-17-7-9-22(10-8-17)12-14-1-3-15(13-23)4-2-14/h1-6,11,17,23H,7-10,12-13H2 |
| InChIKey | CFEJWKDEPMLNQJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |