C18H23NO2 — CID 110009129
3-[[4-(hydroxymethyl)phenyl]methyl-methylamino]-3-phenylpropan-1-ol (PubChem CID 110009129) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[[4-(hydroxymethyl)phenyl]methyl-methylamino]-3-phenylpropan-1-ol.
| Compound Name | 3-[[4-(hydroxymethyl)phenyl]methyl-methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 110009129 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[[4-(hydroxymethyl)phenyl]methyl-methylamino]-3-phenylpropan-1-ol |
| SMILES | CN(Cc1ccc(CO)cc1)C(CCO)c1ccccc1 |
| InChI | InChI=1S/C18H23NO2/c1-19(13-15-7-9-16(14-21)10-8-15)18(11-12-20)17-5-3-2-4-6-17/h2-10,18,20-21H,11-14H2,1H3 |
| InChIKey | WIMPPWNJOJQQAB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |