C19H25NO3 — CID 111489124
3-[(2,5-dimethoxyphenyl)methyl-methylamino]-3-phenylpropan-1-ol (PubChem CID 111489124) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)methyl-methylamino]-3-phenylpropan-1-ol.
| Compound Name | 3-[(2,5-dimethoxyphenyl)methyl-methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 111489124 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)methyl-methylamino]-3-phenylpropan-1-ol |
| SMILES | COc1ccc(OC)c(CN(C)C(CCO)c2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO3/c1-20(18(11-12-21)15-7-5-4-6-8-15)14-16-13-17(22-2)9-10-19(16)23-3/h4-10,13,18,21H,11-12,14H2,1-3H3 |
| InChIKey | ZLQJQUYWHDKNLN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |