C19H22N2O4 — CID 110009206
2-[2,3-dihydro-1H-inden-1-yl-[(3-methoxy-4-nitrophenyl)methyl]amino]ethanol (PubChem CID 110009206) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-1-yl-[(3-methoxy-4-nitrophenyl)methyl]amino]ethanol.
| Compound Name | 2-[2,3-dihydro-1H-inden-1-yl-[(3-methoxy-4-nitrophenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 110009206 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[2,3-dihydro-1H-inden-1-yl-[(3-methoxy-4-nitrophenyl)methyl]amino]ethanol |
| SMILES | COc1cc(CN(CCO)C2CCc3ccccc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O4/c1-25-19-12-14(6-8-18(19)21(23)24)13-20(10-11-22)17-9-7-15-4-2-3-5-16(15)17/h2-6,8,12,17,22H,7,9-11,13H2,1H3 |
| InChIKey | AATFXIQJILMFCT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|