C19H24ClN3O — CID 110011365
[1-[4-chloro-2-[(5-methyl-2-pyridinyl)methylamino]phenyl]piperidin-4-yl]methanol (PubChem CID 110011365) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is [1-[4-chloro-2-[(5-methyl-2-pyridinyl)methylamino]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-chloro-2-[(5-methyl-2-pyridinyl)methylamino]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 110011365 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [1-[4-chloro-2-[(5-methyl-2-pyridinyl)methylamino]phenyl]piperidin-4-yl]methanol |
| SMILES | Cc1ccc(CNc2cc(Cl)ccc2N2CCC(CO)CC2)nc1 |
| InChI | InChI=1S/C19H24ClN3O/c1-14-2-4-17(21-11-14)12-22-18-10-16(20)3-5-19(18)23-8-6-15(13-24)7-9-23/h2-5,10-11,15,22,24H,6-9,12-13H2,1H3 |
| InChIKey | VKUIAUVUTKIPMV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |