C21H26ClN3O3 — CID 71848299
2-[5-chloro-2-[4-(hydroxymethyl)piperidin-1-yl]anilino]-N-(2-methoxyphenyl)acetamide (PubChem CID 71848299) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 2-[5-chloro-2-[4-(hydroxymethyl)piperidin-1-yl]anilino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[5-chloro-2-[4-(hydroxymethyl)piperidin-1-yl]anilino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71848299 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-[5-chloro-2-[4-(hydroxymethyl)piperidin-1-yl]anilino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CNc1cc(Cl)ccc1N1CCC(CO)CC1 |
| InChI | InChI=1S/C21H26ClN3O3/c1-28-20-5-3-2-4-17(20)24-21(27)13-23-18-12-16(22)6-7-19(18)25-10-8-15(14-26)9-11-25/h2-7,12,15,23,26H,8-11,13-14H2,1H3,(H,24,27) |
| InChIKey | JYUDLXKCMBWAJO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |