C13H22N4O2 — CID 110017089
N-(2-hydroxyethyl)-2-[4-[(3-methylcyclopentyl)amino]pyrazol-1-yl]acetamide (PubChem CID 110017089) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-[(3-methylcyclopentyl)amino]pyrazol-1-yl]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-[(3-methylcyclopentyl)amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 110017089 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-[(3-methylcyclopentyl)amino]pyrazol-1-yl]acetamide |
| SMILES | CC1CCC(Nc2cnn(CC(=O)NCCO)c2)C1 |
| InChI | InChI=1S/C13H22N4O2/c1-10-2-3-11(6-10)16-12-7-15-17(8-12)9-13(19)14-4-5-18/h7-8,10-11,16,18H,2-6,9H2,1H3,(H,14,19) |
| InChIKey | ONKSXEGLCPHGPZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |