C16H26N4O — CID 60932315
2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pyrazol-1-yl]-N-methylacetamide (PubChem CID 60932315) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pyrazol-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pyrazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 60932315 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ylamino)pyrazol-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cn1cc(NC2CCC3CCCCC3C2)cn1 |
| InChI | InChI=1S/C16H26N4O/c1-17-16(21)11-20-10-15(9-18-20)19-14-7-6-12-4-2-3-5-13(12)8-14/h9-10,12-14,19H,2-8,11H2,1H3,(H,17,21) |
| InChIKey | NHXXQFPWAKWUDS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |