C17H16N2O3 — CID 110017588
(E)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(5-hydroxy-3-pyridinyl)prop-2-enamide (PubChem CID 110017588) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (E)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(5-hydroxy-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(5-hydroxy-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 110017588 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (E)-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(5-hydroxy-3-pyridinyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cncc(O)c1)NC1c2ccccc2CC1O |
| InChI | InChI=1S/C17H16N2O3/c20-13-7-11(9-18-10-13)5-6-16(22)19-17-14-4-2-1-3-12(14)8-15(17)21/h1-7,9-10,15,17,20-21H,8H2,(H,19,22)/b6-5+ |
| InChIKey | JUKZKFMQUQPJMW-AATRIKPKSA-N |
| XLogP | 1.57 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|