C16H14BrNO2S — CID 103816759
(E)-3-(5-bromothiophen-2-yl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]prop-2-enamide (PubChem CID 103816759) has the molecular formula C16H14BrNO2S and a molecular weight of 364.26 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 103816759 |
| Molecular Formula | C16H14BrNO2S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C16H14BrNO2S/c17-14-7-5-11(21-14)6-8-15(20)18-16-12-4-2-1-3-10(12)9-13(16)19/h1-8,13,16,19H,9H2,(H,18,20)/b8-6+/t13-,16+/m1/s1 |
| InChIKey | MYLDOAFSNDERQL-PSYXSKQDSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|